Products 250674-53-4

CAS 250674-53-4 is the registry number for Ethyl 1,7-naphthyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 1,7-naphthyridine-2-carboxylate (CAS 250674-53-4) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: ethyl 1,7-naphthyridine-2-carboxylate. InChIKey: VZLMYXFLIYXAQW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O2
Molecular weight202.21 g/mol
IUPAC nameethyl 1,7-naphthyridine-2-carboxylate
InChIKeyVZLMYXFLIYXAQW-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC2=C(C=C1)C=CN=C2

Computed by PubChem (NCBI)