CAS 250674-53-4 is the registry number for Ethyl 1,7-naphthyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 1,7-naphthyridine-2-carboxylate (CAS 250674-53-4) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: ethyl 1,7-naphthyridine-2-carboxylate. InChIKey: VZLMYXFLIYXAQW-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | ethyl 1,7-naphthyridine-2-carboxylate |
| InChIKey | VZLMYXFLIYXAQW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=C1)C=CN=C2 |
Computed by PubChem (NCBI)