CAS 25078-04-0 appears in our catalog under these names: 2,4–Dimethyldiphenylamine, 2,4-Dimethyldiphenylamine, >98.0%(GC), 2,4-Dimethyl-N-phenylaniline 98%, 2,4-Dimethyl-N-phenylaniline, 98%, 98%, 2,4-Dimethyl-N-phenylaniline, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 10g, 1g.
2,4-dimethyl-N-phenylaniline (CAS 25078-04-0) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 2,4-dimethyl-N-phenylaniline. InChIKey: BWYYRZBQXLCZJL-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 2,4-dimethyl-N-phenylaniline |
| InChIKey | BWYYRZBQXLCZJL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC2=CC=CC=C2)C |
Computed by PubChem (NCBI)