Products 2510-38-5
CAS 2510-38-5 appears in our catalog under these names: (R)-2-Acetamido-3-mercapto-3-methylbutanoic acid, 97%, 97%, (R)-2-Acetamido-3-mercapto-3-methylbutanoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-acetamido-3-methyl-3-sulfanylbutanoic acid (CAS 2510-38-5) is a chemical compound with the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. IUPAC name: (2R)-2-acetamido-3-methyl-3-sulfanylbutanoic acid. InChIKey: MNNBCKASUFBXCO-RXMQYKEDSA-N.
| Molecular formula | C7H13NO3S |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | (2R)-2-acetamido-3-methyl-3-sulfanylbutanoic acid |
| InChIKey | MNNBCKASUFBXCO-RXMQYKEDSA-N |
| SMILES | CC(=O)N[C@H](C(=O)O)C(C)(C)S |
Computed by PubChem (NCBI)
Synonyms:
N-Acetylpenicillamine, (l)-, L-N-Acetylpenicillamine, Acetylpenicillamine, (R)-2-Acetamido-3-mercapto-3-methylbutanoic acid, (2R)-2-acetamido-3-methyl-3-sulfanylbutanoic acid, L-Valine, N-acetyl-3-mercapto-, N-ACETYL PENICILLAMINE, N-Acetyl-3-sulfanylvaline #, Valine, N-acetyl-3-mercapto-, L-N-Acetyl-beta-mercaptovaline