Products 2512218-64-1
CAS 2512218-64-1 is the registry number for O1-tert-butyl O3-methyl (3S)-3-aminopiperidine-1,3-dicarboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
1-O-tert-butyl 3-O-methyl (3S)-3-aminopiperidine-1,3-dicarboxylate (CAS 2512218-64-1) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S)-3-aminopiperidine-1,3-dicarboxylate. InChIKey: VUKOJTPPLYJJTI-LBPRGKRZSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S)-3-aminopiperidine-1,3-dicarboxylate |
| InChIKey | VUKOJTPPLYJJTI-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@](C1)(C(=O)OC)N |
Computed by PubChem (NCBI)