Products 251320-83-9
CAS 251320-83-9 is the registry number for 4'-(tert-Butyl)-2,6-dimethyl-1,1'-biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(4-tert-butylphenyl)-1,3-dimethylbenzene (CAS 251320-83-9) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-1,3-dimethylbenzene. InChIKey: JRHATMRTHCJWTD-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-1,3-dimethylbenzene |
| InChIKey | JRHATMRTHCJWTD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)