CAS 69375-12-8 is the registry number for 3,3'-Diisopropylbiphenyl. Offered by: TRC. Available pack sizes: 250mg.
1-propan-2-yl-3-(3-propan-2-ylphenyl)benzene (CAS 69375-12-8) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: 1-propan-2-yl-3-(3-propan-2-ylphenyl)benzene. InChIKey: PYXYYRWLLNHRLM-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | 1-propan-2-yl-3-(3-propan-2-ylphenyl)benzene |
| InChIKey | PYXYYRWLLNHRLM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC(=C1)C2=CC(=CC=C2)C(C)C |
Computed by PubChem (NCBI)