CAS 25141-39-3 is the registry number for 2-(2-Chloro-3,5-dimethylphenoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chloro-3,5-dimethylphenoxy)acetic acid (CAS 25141-39-3) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 2-(2-chloro-3,5-dimethylphenoxy)acetic acid. InChIKey: SXMGUAZBXWAQAQ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 2-(2-chloro-3,5-dimethylphenoxy)acetic acid |
| InChIKey | SXMGUAZBXWAQAQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OCC(=O)O)Cl)C |
Computed by PubChem (NCBI)