Products 2514949-33-6

CAS 2514949-33-6 is the registry number for 4-Azido-d-phenylalanine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(2R)-2-amino-3-(4-azidophenyl)propanoic acid;hydrochloride (CAS 2514949-33-6) is a chemical compound with the molecular formula C9H11ClN4O2 and a molecular weight of 242.66 g/mol. IUPAC name: (2R)-2-amino-3-(4-azidophenyl)propanoic acid;hydrochloride. InChIKey: VXCXRGSRHCHMBK-DDWIOCJRSA-N.

Identity
Molecular formulaC9H11ClN4O2
Molecular weight242.66 g/mol
IUPAC name(2R)-2-amino-3-(4-azidophenyl)propanoic acid;hydrochloride
InChIKeyVXCXRGSRHCHMBK-DDWIOCJRSA-N
SMILESC1=CC(=CC=C1C[C@H](C(=O)O)N)N=[N+]=[N-].Cl

Computed by PubChem (NCBI)