CAS 330550-92-0 appears in our catalog under these names: 2-Chloro-n-cyclopentyl-5-nitropyrimidin-4-amine, 95%, (2–Chloro–5–nitro–pyrimidin–4–yl)–cyclopentyl–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
2-chloro-N-cyclopentyl-5-nitropyrimidin-4-amine (CAS 330550-92-0) is a chemical compound with the molecular formula C9H11ClN4O2 and a molecular weight of 242.66 g/mol. IUPAC name: 2-chloro-N-cyclopentyl-5-nitropyrimidin-4-amine. InChIKey: WCBURNWVRFRXTK-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4O2 |
|---|---|
| Molecular weight | 242.66 g/mol |
| IUPAC name | 2-chloro-N-cyclopentyl-5-nitropyrimidin-4-amine |
| InChIKey | WCBURNWVRFRXTK-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=NC(=NC=C2[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)