Products 2514953-39-8

CAS 2514953-39-8 is the registry number for Di-p-tolyl-phosphate-d14, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.

Structural formula: {0} (CAS {1})

Bis[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl] hydrogen phosphate (CAS 2514953-39-8) is a chemical compound with the molecular formula C14H15O4P and a molecular weight of 292.33 g/mol. IUPAC name: bis[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl] hydrogen phosphate. InChIKey: PLUDEAUQZKPAIN-DDAUHAMOSA-N.

Identity
Molecular formulaC14H15O4P
Molecular weight292.33 g/mol
IUPAC namebis[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl] hydrogen phosphate
InChIKeyPLUDEAUQZKPAIN-DDAUHAMOSA-N
SMILES[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])OP(=O)(O)OC2=C(C(=C(C(=C2[2H])[2H])C([2H])([2H])[2H])[2H])[2H])[2H]

Computed by PubChem (NCBI)