Products 35787-74-7
CAS 35787-74-7 appears in our catalog under these names: Di-o-tolyl phosphate, Di-o-tolyl-phosphate, >95% (HPLC), Di-o-tolyl-phosphate-d14, Di-o-tolyl-phosphate, ≥95%, ≥95%, Di-o-cresyl phosphate. Offered by: Dr. Ehrenstorfer, TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 100mg, 1g, 2mg, 1mg, 5mg, 10mg, 250mg.
Bis(2-methylphenyl) hydrogen phosphate (CAS 35787-74-7) is a chemical compound with the molecular formula C14H15O4P and a molecular weight of 278.24 g/mol. IUPAC name: bis(2-methylphenyl) hydrogen phosphate. InChIKey: OHRCKPRYDGSBRN-UHFFFAOYSA-N.
| Molecular formula | C14H15O4P |
|---|---|
| Molecular weight | 278.24 g/mol |
| IUPAC name | bis(2-methylphenyl) hydrogen phosphate |
| InChIKey | OHRCKPRYDGSBRN-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OP(=O)(O)OC2=CC=CC=C2C |
Computed by PubChem (NCBI)
Synonyms:
Di-o-cresyl phosphate, Phosphoric acid di-o-tolyl ester, Phosphoric acid, bis(2-methylphenyl) ester, Di-o-tolyl-phosphate, bis(2-methylphenyl) hydrogen phosphate, Bis(2-methylphenoxy)phosphinic Acid, Di-o-tolyl hydrogen phosphate, di-o-cresyl hydrogen phosphate, orb3144867, Di-O-Tolyl-Phosphate Solution in Acetonitrile, 100_g/mL