CAS 2517379-41-6 appears in our catalog under these names: Di–o–tolyl–phosphate–d14, Di-o-tolyl-phosphate-d14, 99.34%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
Bis[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenyl] hydrogen phosphate (CAS 2517379-41-6) is a chemical compound with the molecular formula C14H15O4P and a molecular weight of 292.33 g/mol. IUPAC name: bis[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenyl] hydrogen phosphate. InChIKey: OHRCKPRYDGSBRN-DDAUHAMOSA-N.
| Molecular formula | C14H15O4P |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | bis[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenyl] hydrogen phosphate |
| InChIKey | OHRCKPRYDGSBRN-DDAUHAMOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])OP(=O)(O)OC2=C(C(=C(C(=C2C([2H])([2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)