Products 692745-01-0

CAS 692745-01-0 is the registry number for Isopropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Propan-2-yl 2-amino-4-methyl-1,3-thiazole-5-carboxylate (CAS 692745-01-0) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: propan-2-yl 2-amino-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: NECZLUPCQZMZMC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O2S
Molecular weight200.26 g/mol
IUPAC namepropan-2-yl 2-amino-4-methyl-1,3-thiazole-5-carboxylate
InChIKeyNECZLUPCQZMZMC-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)N)C(=O)OC(C)C

Computed by PubChem (NCBI)