CAS 692745-01-0 is the registry number for Isopropyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Propan-2-yl 2-amino-4-methyl-1,3-thiazole-5-carboxylate (CAS 692745-01-0) is a chemical compound with the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. IUPAC name: propan-2-yl 2-amino-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: NECZLUPCQZMZMC-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | propan-2-yl 2-amino-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | NECZLUPCQZMZMC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)C(=O)OC(C)C |
Computed by PubChem (NCBI)