Products 2516234-45-8
CAS 2516234-45-8 is the registry number for Oseltamivir Impurity 140. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3S,4R,5S)-4-acetamido-3-amino-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]heptane-1-carboxylate (CAS 2516234-45-8) is a chemical compound with the molecular formula C16H28N2O5 and a molecular weight of 328.40 g/mol. IUPAC name: ethyl (3S,4R,5S)-4-acetamido-3-amino-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]heptane-1-carboxylate. InChIKey: HXEYTRRNOXXMMJ-DYTRIANISA-N.
| Molecular formula | C16H28N2O5 |
|---|---|
| Molecular weight | 328.40 g/mol |
| IUPAC name | ethyl (3S,4R,5S)-4-acetamido-3-amino-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]heptane-1-carboxylate |
| InChIKey | HXEYTRRNOXXMMJ-DYTRIANISA-N |
| SMILES | CCC(CC)O[C@H]1[C@@H]([C@H](CC2(C1O2)C(=O)OCC)N)NC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Oseltamivir Impurity 140