Products 862703-10-4

CAS 862703-10-4 is the registry number for 1,5-(Di-boc)-3-oxo-1,5-diazocane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ditert-butyl 3-oxo-1,5-diazocane-1,5-dicarboxylate (CAS 862703-10-4) is a chemical compound with the molecular formula C16H28N2O5 and a molecular weight of 328.40 g/mol. IUPAC name: ditert-butyl 3-oxo-1,5-diazocane-1,5-dicarboxylate. InChIKey: JGXZBEVKVNMXDF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H28N2O5
Molecular weight328.40 g/mol
IUPAC nameditert-butyl 3-oxo-1,5-diazocane-1,5-dicarboxylate
InChIKeyJGXZBEVKVNMXDF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCN(CC(=O)C1)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)