Products 64205-66-9
CAS 64205-66-9 appears in our catalog under these names: Boc-Leu-Pro-OH, Boc–Leu–Pro–OH. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 2g.
(2S)-1-[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]pyrrolidine-2-carboxylic acid (CAS 64205-66-9) is a chemical compound with the molecular formula C16H28N2O5 and a molecular weight of 328.40 g/mol. IUPAC name: (2S)-1-[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]pyrrolidine-2-carboxylic acid. InChIKey: IWCSBUBELIDSKW-RYUDHWBXSA-N.
| Molecular formula | C16H28N2O5 |
|---|---|
| Molecular weight | 328.40 g/mol |
| IUPAC name | (2S)-1-[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | IWCSBUBELIDSKW-RYUDHWBXSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)