Products 2516239-95-3
CAS 2516239-95-3 is the registry number for 5-Chloro-1,3-dihydro-1,3,3-trimethyl-2H-pyrrolo[2,3-c]pyridin-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-chloro-1,3,3-trimethylpyrrolo[2,3-c]pyridin-2-one (CAS 2516239-95-3) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 5-chloro-1,3,3-trimethylpyrrolo[2,3-c]pyridin-2-one. InChIKey: RNOKQVXWKKHQBR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 5-chloro-1,3,3-trimethylpyrrolo[2,3-c]pyridin-2-one |
| InChIKey | RNOKQVXWKKHQBR-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC(=NC=C2N(C1=O)C)Cl)C |
Computed by PubChem (NCBI)