CAS 25170-60-9 is the registry number for 2-Hydroxy-5-(1-(4-hydroxyphenyl)-1-methylethyl)benzenemethanol. Offered by: TRC. Available pack sizes: 2,5g.
2-(hydroxymethyl)-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol (CAS 25170-60-9) is a chemical compound with the molecular formula C16H18O3 and a molecular weight of 258.31 g/mol. IUPAC name: 2-(hydroxymethyl)-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol. InChIKey: KIWOCFLXYKVVCA-UHFFFAOYSA-N.
| Molecular formula | C16H18O3 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 2-(hydroxymethyl)-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| InChIKey | KIWOCFLXYKVVCA-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC(=C(C=C2)O)CO |
Computed by PubChem (NCBI)