Products 25173-75-5
CAS 25173-75-5 appears in our catalog under these names: 3-(2,5-Dimethylphenyl)propionic acid, 95%, 3-(2,5-Dimethylphenyl)propionic acid, 3-(2,5-Dimethylphenyl)propionic acid 95%, 3-(2,5-Dimethylphenyl)propionic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-(2,5-dimethylphenyl)propanoic acid (CAS 25173-75-5) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 3-(2,5-dimethylphenyl)propanoic acid. InChIKey: YJUKGBIRIXQUJY-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 3-(2,5-dimethylphenyl)propanoic acid |
| InChIKey | YJUKGBIRIXQUJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CCC(=O)O |
Computed by PubChem (NCBI)