CAS 2518-24-3 appears in our catalog under these names: 3–Aminophthalimide, 3-Aminophthalimide, 98%, 3-Aminophthalimide, 97%, 97%, 4-Aminoisoindoline-1,3-dione, >95.0%(GC), 4-Amino-1H-isoindole-1,3(2H)-dione, 97%. Offered by: GLPBio, Combi-blocks, Chemat, TCI, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 1g, 250mg.
4-aminoisoindole-1,3-dione (CAS 2518-24-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 4-aminoisoindole-1,3-dione. InChIKey: GQBONCZDJQXPLV-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4-aminoisoindole-1,3-dione |
| InChIKey | GQBONCZDJQXPLV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)NC2=O |
Computed by PubChem (NCBI)