Products 252025-48-2
CAS 252025-48-2 is the registry number for AF-2785. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]prop-2-enoic acid (CAS 252025-48-2) is a chemical compound with the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.2 g/mol. IUPAC name: (E)-3-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]prop-2-enoic acid. InChIKey: JXBHFVLHFJMKPK-BQYQJAHWSA-N.
| Molecular formula | C17H12Cl2N2O2 |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]indazol-3-yl]prop-2-enoic acid |
| InChIKey | JXBHFVLHFJMKPK-BQYQJAHWSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2CC3=C(C=C(C=C3)Cl)Cl)/C=C/C(=O)O |
Computed by PubChem (NCBI)