CAS 2522-81-8 is the registry number for Pibecarb. Offered by: TRC. Available pack sizes: 1g.
Phenacyl 2,2-dimethylpropanoate (CAS 2522-81-8) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: phenacyl 2,2-dimethylpropanoate. InChIKey: OTIZTAXUFMCICV-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | phenacyl 2,2-dimethylpropanoate |
| InChIKey | OTIZTAXUFMCICV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OCC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)