Products 25225-08-5

CAS 25225-08-5 is the registry number for α,3,3-Trimethylcyclohexanemethyl formate, 80%, 80%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

1-(3,3-dimethylcyclohexyl)ethyl formate (CAS 25225-08-5) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: 1-(3,3-dimethylcyclohexyl)ethyl formate. InChIKey: NFASPEPDTMCBEN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20O2
Molecular weight184.27 g/mol
IUPAC name1-(3,3-dimethylcyclohexyl)ethyl formate
InChIKeyNFASPEPDTMCBEN-UHFFFAOYSA-N
SMILESCC(C1CCCC(C1)(C)C)OC=O

Computed by PubChem (NCBI)