CAS 252573-77-6 appears in our catalog under these names: Ezetimibe Impurity 130, 2-((E)-((4-Fluorophenyl)imino)methyl)phenol, (E)-2-(((4-Fluorophenyl)imino)methyl)phenol 95%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed. Available pack sizes: on request, 1g, 250mg, 500mg, 1000mg, 5000mg, 100mg, 5g.
2-[(4-fluorophenyl)iminomethyl]phenol (CAS 252573-77-6) is a chemical compound with the molecular formula C13H10FNO and a molecular weight of 215.22 g/mol. IUPAC name: 2-[(4-fluorophenyl)iminomethyl]phenol. InChIKey: COFLOZFCNFCJFM-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO |
|---|---|
| Molecular weight | 215.22 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)iminomethyl]phenol |
| InChIKey | COFLOZFCNFCJFM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NC2=CC=C(C=C2)F)O |
Computed by PubChem (NCBI)