Products 580-74-5
CAS 580-74-5 is the registry number for Xantocillin. Offered by: Biosynth. Available pack sizes: 1g.
4-[(1Z,3Z)-4-(4-hydroxyphenyl)-2,3-diisocyanobuta-1,3-dienyl]phenol (CAS 580-74-5) is a chemical compound with the molecular formula C18H12N2O2 and a molecular weight of 288.3 g/mol. IUPAC name: 4-[(1Z,3Z)-4-(4-hydroxyphenyl)-2,3-diisocyanobuta-1,3-dienyl]phenol. InChIKey: YBMVKDUTYAGKEW-WHYMJUELSA-N.
| Molecular formula | C18H12N2O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 4-[(1Z,3Z)-4-(4-hydroxyphenyl)-2,3-diisocyanobuta-1,3-dienyl]phenol |
| InChIKey | YBMVKDUTYAGKEW-WHYMJUELSA-N |
| SMILES | [C-]#[N+]/C(=C\C1=CC=C(C=C1)O)/C(=C/C2=CC=C(C=C2)O)/[N+]#[C-] |
Computed by PubChem (NCBI)
Synonyms:
Xantocillin, Xanthocillin X, Brevicid, Ophthocillin, Xanthocillinum, Xantocilina, Brevicide, Trianthil, Xantyrid, Brevicide-X