CAS 1141931-60-3 is the registry number for 2-(Naphthalen-2-yl)-1H-1,3-benzodiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-naphthalen-2-yl-3H-benzimidazole-5-carboxylic acid (CAS 1141931-60-3) is a chemical compound with the molecular formula C18H12N2O2 and a molecular weight of 288.3 g/mol. IUPAC name: 2-naphthalen-2-yl-3H-benzimidazole-5-carboxylic acid. InChIKey: WXIPFSQLKFPXOE-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 2-naphthalen-2-yl-3H-benzimidazole-5-carboxylic acid |
| InChIKey | WXIPFSQLKFPXOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NC4=C(N3)C=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)