CAS 252873-51-1 is the registry number for (3R,3aR,6aS)-Hexahydrofuro(2,3-b)furan-3-yl 4-Nitrophenyl Ester Carbonic Acid. Offered by: TRC. Available pack sizes: 100mg.
[(3aR,4R,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate (CAS 252873-51-1) is a chemical compound with the molecular formula C13H13NO7 and a molecular weight of 295.24 g/mol. IUPAC name: [(3aR,4R,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate. InChIKey: ULTSJNOQNKVDBM-WOPDTQHZSA-N.
| Molecular formula | C13H13NO7 |
|---|---|
| Molecular weight | 295.24 g/mol |
| IUPAC name | [(3aR,4R,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate |
| InChIKey | ULTSJNOQNKVDBM-WOPDTQHZSA-N |
| SMILES | C1CO[C@@H]2[C@H]1[C@H](CO2)OC(=O)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)