Products 252873-01-1
CAS 252873-01-1 appears in our catalog under these names: Darunavir Impurity 28, (3S,3aS,6aR)-Hexahydrofuro(2,3-b)furan-3-yl 4-Nitrophenyl Ester Carbonic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
[(3aS,4S,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate (CAS 252873-01-1) is a chemical compound with the molecular formula C13H13NO7 and a molecular weight of 295.24 g/mol. IUPAC name: [(3aS,4S,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate. InChIKey: ULTSJNOQNKVDBM-QJPTWQEYSA-N.
| Molecular formula | C13H13NO7 |
|---|---|
| Molecular weight | 295.24 g/mol |
| IUPAC name | [(3aS,4S,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate |
| InChIKey | ULTSJNOQNKVDBM-QJPTWQEYSA-N |
| SMILES | C1CO[C@H]2[C@@H]1[C@@H](CO2)OC(=O)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
BIS THF Nitro Derivative 2, (3S,3aS,6aR)-Hexahydrofuro[2,3-b]furan-3-yl 4-Nitrophenyl Ester Carbonic Acid, (3S,3AS,6aR)-hexahydrofuro[2,3-b]furan-3-yl (4-nitrophenyl) carbonate, Darunavir Impurity 9, BIS THF Nitroderivative 2, >98%, (3S,3aS,6aR)-Hexahydrofuro[2,3-b]furan-3-yl 4-nitrophenyl carbonate, Carbonic acid, (3S,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-yl 4-nitrophenyl ester