CAS 860295-20-1 appears in our catalog under these names: N-((2E)-3-(3,4-Dihydroxyphenyl)-1-oxo-2-propen-1-yl)-L-aspartic acid, N-((2E)-3-(3,4-Dihydroxyphenyl)-1-oxo-2-propen-1-yl)-L-aspartic Acid, >95% (HPLC), (+)-N-[3',4'-Dihydroxy-(E)-cinnamoyl]-L-aspartic acid. Offered by: Biosynth, TRC, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, Get quote.
(2S)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]butanedioic acid (CAS 860295-20-1) is a chemical compound with the molecular formula C13H13NO7 and a molecular weight of 295.24 g/mol. IUPAC name: (2S)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]butanedioic acid. InChIKey: YNHFZQQNJPOYRC-KHVHVRLGSA-N.
| Molecular formula | C13H13NO7 |
|---|---|
| Molecular weight | 295.24 g/mol |
| IUPAC name | (2S)-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]butanedioic acid |
| InChIKey | YNHFZQQNJPOYRC-KHVHVRLGSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)N[C@@H](CC(=O)O)C(=O)O)O)O |
Computed by PubChem (NCBI)