CAS 252928-92-0 appears in our catalog under these names: 3-(4H-1,2,4-Triazol-4-yl)aniline, 95%, 3–(4H–1,2,4–Triazol–4–yl)aniline, 3-(1,2,4)Triazol-4-yl-phenylamine, 3-(4H-1,2,4-Triazol-4-yl)aniline 95%, 3-(4H-1,2,4-triazol-4-yl)aniline, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 10g, 5g.
3-(1,2,4-triazol-4-yl)aniline (CAS 252928-92-0) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 3-(1,2,4-triazol-4-yl)aniline. InChIKey: WPGPBPCIYBWYMQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 3-(1,2,4-triazol-4-yl)aniline |
| InChIKey | WPGPBPCIYBWYMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=NN=C2)N |
Computed by PubChem (NCBI)