CAS 25297-48-7 is the registry number for 6-Chloro-4-phenyl-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-4-phenyl-1H-pyridin-2-one (CAS 25297-48-7) is a chemical compound with the molecular formula C11H8ClNO and a molecular weight of 205.64 g/mol. IUPAC name: 6-chloro-4-phenyl-1H-pyridin-2-one. InChIKey: GFGDKLZHRLWMNN-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 6-chloro-4-phenyl-1H-pyridin-2-one |
| InChIKey | GFGDKLZHRLWMNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)NC(=C2)Cl |
Computed by PubChem (NCBI)