Products 253175-75-6

CAS 253175-75-6 is the registry number for 1-tert-Butyl 4-isobutyl piperazine-1,4-dicarboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g.

4-O-tert-butyl 1-O-(2-methylpropyl) piperazine-1,4-dicarboxylate (CAS 253175-75-6) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: 4-O-tert-butyl 1-O-(2-methylpropyl) piperazine-1,4-dicarboxylate. InChIKey: OOKHLDJPLKKSLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H26N2O4
Molecular weight286.37 g/mol
IUPAC name4-O-tert-butyl 1-O-(2-methylpropyl) piperazine-1,4-dicarboxylate
InChIKeyOOKHLDJPLKKSLZ-UHFFFAOYSA-N
SMILESCC(C)COC(=O)N1CCN(CC1)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)