CAS 253265-98-4 appears in our catalog under these names: BIS THF HNS Derivative 1, 1-(((((3S,3aR,6aS)-Hexahydrofuro(2,3-b)furan-3-yl)oxy)carbonyl)oxy)-2,5-pyrrolidinedione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
[(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (2,5-dioxopyrrolidin-1-yl) carbonate (CAS 253265-98-4) is a chemical compound with the molecular formula C11H13NO7 and a molecular weight of 271.22 g/mol. IUPAC name: [(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: VCFNCYVHQSHFRH-XSSZXYGBSA-N.
| Molecular formula | C11H13NO7 |
|---|---|
| Molecular weight | 271.22 g/mol |
| IUPAC name | [(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | VCFNCYVHQSHFRH-XSSZXYGBSA-N |
| SMILES | C1CO[C@@H]2[C@H]1[C@@H](CO2)OC(=O)ON3C(=O)CCC3=O |
Computed by PubChem (NCBI)