Products 879361-47-4
CAS 879361-47-4 appears in our catalog under these names: 5-Methoxy-4-(2-methoxyethoxy)-2-nitrobenzoic acid, 5-Methoxy-4-(2-methoxyethoxy)-2-nitrobenzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzoic acid (CAS 879361-47-4) is a chemical compound with the molecular formula C11H13NO7 and a molecular weight of 271.22 g/mol. IUPAC name: 5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzoic acid. InChIKey: IVXTUVDBRCQWGF-UHFFFAOYSA-N.
| Molecular formula | C11H13NO7 |
|---|---|
| Molecular weight | 271.22 g/mol |
| IUPAC name | 5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzoic acid |
| InChIKey | IVXTUVDBRCQWGF-UHFFFAOYSA-N |
| SMILES | COCCOC1=C(C=C(C(=C1)[N+](=O)[O-])C(=O)O)OC |
Computed by PubChem (NCBI)