CAS 72732-54-8 appears in our catalog under these names: 4-Nitrophenyl beta-l-arabinopyranoside, 95%, 4-Nitrophenyl b-L-Arabinopyranoside, 4–Nitrophenyl–beta–l–arabinopyranoside, (2R,3R,4S,5S)-2-(4-Nitrophenoxy)tetrahydro-2H-pyran-3,4,5-triol, 95%, 95%, 4-Nitrophenyl β-L-arabinopyranoside. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 0,5g, 2g, 5g, 100mg, Get quote.
(2R,3R,4S,5S)-2-(4-nitrophenoxy)oxane-3,4,5-triol (CAS 72732-54-8) is a chemical compound with the molecular formula C11H13NO7 and a molecular weight of 271.22 g/mol. IUPAC name: (2R,3R,4S,5S)-2-(4-nitrophenoxy)oxane-3,4,5-triol. InChIKey: MLJYKRYCCUGBBV-UKKRHICBSA-N.
| Molecular formula | C11H13NO7 |
|---|---|
| Molecular weight | 271.22 g/mol |
| IUPAC name | (2R,3R,4S,5S)-2-(4-nitrophenoxy)oxane-3,4,5-triol |
| InChIKey | MLJYKRYCCUGBBV-UKKRHICBSA-N |
| SMILES | C1[C@@H]([C@@H]([C@H]([C@H](O1)OC2=CC=C(C=C2)[N+](=O)[O-])O)O)O |
Computed by PubChem (NCBI)