Products 25361-94-8
CAS 25361-94-8 is the registry number for 2,3-Bis(4-methoxyphenyl)cyclopropenone. Offered by: TRC. Available pack sizes: 250mg.
2,3-bis(4-methoxyphenyl)cycloprop-2-en-1-one (CAS 25361-94-8) is a chemical compound with the molecular formula C17H14O3 and a molecular weight of 266.29 g/mol. IUPAC name: 2,3-bis(4-methoxyphenyl)cycloprop-2-en-1-one. InChIKey: NPOLTJNFAQNEAA-UHFFFAOYSA-N.
| Molecular formula | C17H14O3 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 2,3-bis(4-methoxyphenyl)cycloprop-2-en-1-one |
| InChIKey | NPOLTJNFAQNEAA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C2=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)