Products 25364-44-7
CAS 25364-44-7 appears in our catalog under these names: Mesitylimidazole, 1-Mesityl-1H-imidazole 97%, 1-Mesityl-1H-imidazole, 97%, 97%, N-Mesitylimidazole, 98%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 50g, 250g, 100mg, 250mg.
1-(2,4,6-trimethylphenyl)imidazole (CAS 25364-44-7) is a chemical compound with the molecular formula C12H14N2 and a molecular weight of 186.25 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)imidazole. InChIKey: XEFLCLZQKDDENB-UHFFFAOYSA-N.
| Molecular formula | C12H14N2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)imidazole |
| InChIKey | XEFLCLZQKDDENB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=CN=C2)C |
Computed by PubChem (NCBI)