CAS 254115-68-9 appears in our catalog under these names: (3S)-tert-Butyl 3-(dimethylcarbamoyl)pyrrolidine-1-carboxylate, 95%, (3S)-tert-Butyl 3-(dimethylcarbamoyl)pyrrolidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl (3S)-3-(dimethylcarbamoyl)pyrrolidine-1-carboxylate (CAS 254115-68-9) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: tert-butyl (3S)-3-(dimethylcarbamoyl)pyrrolidine-1-carboxylate. InChIKey: UZAQZYVMEDKWDH-VIFPVBQESA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | tert-butyl (3S)-3-(dimethylcarbamoyl)pyrrolidine-1-carboxylate |
| InChIKey | UZAQZYVMEDKWDH-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)C(=O)N(C)C |
Computed by PubChem (NCBI)