Products 2543578-70-5
CAS 2543578-70-5 is the registry number for 3-(4-Chlorophenyl)-1,5-dihydro-5-thioxo-4H-1,2,4-triazole-4-propanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoic acid (CAS 2543578-70-5) is a chemical compound with the molecular formula C11H10ClN3O2S and a molecular weight of 283.73 g/mol. IUPAC name: 3-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoic acid. InChIKey: BJSABQALLIKLRT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O2S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | 3-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoic acid |
| InChIKey | BJSABQALLIKLRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=S)N2CCC(=O)O)Cl |
Computed by PubChem (NCBI)