CAS 923713-39-7 is the registry number for ([4-(3-Chloro-4-methylphenyl)-4h-1,2,4-triazol-3-yl]thio)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (CAS 923713-39-7) is a chemical compound with the molecular formula C11H10ClN3O2S and a molecular weight of 283.73 g/mol. IUPAC name: 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid. InChIKey: POFFTFMCPKCDSQ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O2S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | 2-[[4-(3-chloro-4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| InChIKey | POFFTFMCPKCDSQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C=NN=C2SCC(=O)O)Cl |
Computed by PubChem (NCBI)