CAS 1049742-69-9 appears in our catalog under these names: 6-(2-Amino-1,3-thiazol-4-yl)-2h-1,4-benzoxazin-3(4h)-one hydrochloride, 95%, 6-(2-Aminothiazol-4-yl)-2H-benzo(b)(1,4)oxazin-3(4H)-one hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 2,5g.
6-(2-amino-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one;hydrochloride (CAS 1049742-69-9) is a chemical compound with the molecular formula C11H10ClN3O2S and a molecular weight of 283.73 g/mol. IUPAC name: 6-(2-amino-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one;hydrochloride. InChIKey: KDIYRDOTLYTTRU-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O2S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | 6-(2-amino-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one;hydrochloride |
| InChIKey | KDIYRDOTLYTTRU-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)C3=CSC(=N3)N.Cl |
Computed by PubChem (NCBI)