CAS 113940-15-1 is the registry number for 5-(Chloromethyl)-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(chloromethyl)-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2-carboxamide (CAS 113940-15-1) is a chemical compound with the molecular formula C11H10ClN3O2S and a molecular weight of 283.73 g/mol. IUPAC name: 5-(chloromethyl)-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2-carboxamide. InChIKey: RPCZBDYLOGCODX-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O2S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | 5-(chloromethyl)-N-(4-methoxyphenyl)-1,3,4-thiadiazole-2-carboxamide |
| InChIKey | RPCZBDYLOGCODX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC(=O)C2=NN=C(S2)CCl |
Computed by PubChem (NCBI)