CAS 25473-71-6 is the registry number for 6-Methoxy-1,3,4,9-tetrahydro-carbazol-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-methoxy-1,3,4,9-tetrahydrocarbazol-2-one (CAS 25473-71-6) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 6-methoxy-1,3,4,9-tetrahydrocarbazol-2-one. InChIKey: JSMBDAPUKORDJR-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 6-methoxy-1,3,4,9-tetrahydrocarbazol-2-one |
| InChIKey | JSMBDAPUKORDJR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC3=C2CCC(=O)C3 |
Computed by PubChem (NCBI)