Products 254974-70-4
CAS 254974-70-4 appears in our catalog under these names: hMAO–B/MB–COMT–IN–1, hMAO-B/MB-COMT-IN-1, 98.04%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 10 mg, 50 mg, 5 mg, 25 mg.
(2E,4E)-5-(3,4-dihydroxyphenyl)-1-piperidin-1-ylpenta-2,4-dien-1-one (CAS 254974-70-4) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: (2E,4E)-5-(3,4-dihydroxyphenyl)-1-piperidin-1-ylpenta-2,4-dien-1-one. InChIKey: ZSGNXVFMAMFAQY-YPCIICBESA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | (2E,4E)-5-(3,4-dihydroxyphenyl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| InChIKey | ZSGNXVFMAMFAQY-YPCIICBESA-N |
| SMILES | C1CCN(CC1)C(=O)/C=C/C=C/C2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)