CAS 2557232-80-9 is the registry number for SARS-CoV-2-IN-115. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[2-(3-aminophenyl)ethynyl]phenyl]acetamide (CAS 2557232-80-9) is a chemical compound with the molecular formula C16H14N2O and a molecular weight of 250.29 g/mol. IUPAC name: N-[4-[2-(3-aminophenyl)ethynyl]phenyl]acetamide. InChIKey: GDYCMPAYKROXHM-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | N-[4-[2-(3-aminophenyl)ethynyl]phenyl]acetamide |
| InChIKey | GDYCMPAYKROXHM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C#CC2=CC(=CC=C2)N |
Computed by PubChem (NCBI)