Products 2558183-91-6
CAS 2558183-91-6 is the registry number for Androgen receptor antagonist 13. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methoxy-N-[4-(1H-pyrazol-5-yl)phenyl]benzenesulfonamide (CAS 2558183-91-6) is a chemical compound with the molecular formula C16H15N3O3S and a molecular weight of 329.4 g/mol. IUPAC name: 4-methoxy-N-[4-(1H-pyrazol-5-yl)phenyl]benzenesulfonamide. InChIKey: ADWATNNUCKDKSR-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O3S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 4-methoxy-N-[4-(1H-pyrazol-5-yl)phenyl]benzenesulfonamide |
| InChIKey | ADWATNNUCKDKSR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)C3=CC=NN3 |
Computed by PubChem (NCBI)
Synonyms:
orb3027646, Androgen receptor antagonist 13