Products 428486-21-9
CAS 428486-21-9 is the registry number for N-((3,4-Dimethylphenyl)carbamothioyl)-2-nitrobenzamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg.
N-[(3,4-dimethylphenyl)carbamothioyl]-2-nitrobenzamide (CAS 428486-21-9) is a chemical compound with the molecular formula C16H15N3O3S and a molecular weight of 329.4 g/mol. IUPAC name: N-[(3,4-dimethylphenyl)carbamothioyl]-2-nitrobenzamide. InChIKey: OVCLDAMMUHRMGD-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O3S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | N-[(3,4-dimethylphenyl)carbamothioyl]-2-nitrobenzamide |
| InChIKey | OVCLDAMMUHRMGD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=S)NC(=O)C2=CC=CC=C2[N+](=O)[O-])C |
Computed by PubChem (NCBI)