Products 74674-35-4

CAS 74674-35-4 is the registry number for 2-(2-(p-Tolylcarbamothioyl)hydrazine-1-carbonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[(4-methylphenyl)carbamothioylamino]carbamoyl]benzoic acid (CAS 74674-35-4) is a chemical compound with the molecular formula C16H15N3O3S and a molecular weight of 329.4 g/mol. IUPAC name: 2-[[(4-methylphenyl)carbamothioylamino]carbamoyl]benzoic acid. InChIKey: FTZCHQOORQBJBL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15N3O3S
Molecular weight329.4 g/mol
IUPAC name2-[[(4-methylphenyl)carbamothioylamino]carbamoyl]benzoic acid
InChIKeyFTZCHQOORQBJBL-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)NC(=S)NNC(=O)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)