Products 2561484-92-0
CAS 2561484-92-0 is the registry number for tert-Butyl 5-methoxy-3-oxo-3,6-dihydropyridine-1(2H)-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
Tert-butyl 3-methoxy-5-oxo-2,6-dihydropyridine-1-carboxylate (CAS 2561484-92-0) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: tert-butyl 3-methoxy-5-oxo-2,6-dihydropyridine-1-carboxylate. InChIKey: LJCBJYGOYCTECS-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | tert-butyl 3-methoxy-5-oxo-2,6-dihydropyridine-1-carboxylate |
| InChIKey | LJCBJYGOYCTECS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=CC(=O)C1)OC |
Computed by PubChem (NCBI)