CAS 25641-99-0 appears in our catalog under these names: α,α,α',α'–Tetrachloro–o–xylene, 1,2-BIS(DICHLOROMETHYL)BENZENE, 97%, 97%, 1,2-BIS(DICHLOROMETHYL)BENZENE, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g.
1,2-bis(dichloromethyl)benzene (CAS 25641-99-0) is a chemical compound with the molecular formula C8H6Cl4 and a molecular weight of 243.9 g/mol. IUPAC name: 1,2-bis(dichloromethyl)benzene. InChIKey: UFJYKWQUTDGGPV-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl4 |
|---|---|
| Molecular weight | 243.9 g/mol |
| IUPAC name | 1,2-bis(dichloromethyl)benzene |
| InChIKey | UFJYKWQUTDGGPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(Cl)Cl)C(Cl)Cl |
Computed by PubChem (NCBI)